About piperidine-3,5-dione;hydrochloride
piperidine-3,5-dione;hydrochloride (PubChem CID 12637127) has the molecular formula C5H8ClNO2
and a molecular weight of 149.58 g/mol. Its IUPAC name is piperidine-3,5-dione;hydrochloride.
Molecular Properties
| Compound Name | piperidine-3,5-dione;hydrochloride |
| PubChem CID | 12637127 |
| Molecular Formula | C5H8ClNO2 |
| Molecular Weight | 149.58 g/mol |
| Exact Mass | 149.02 |
| IUPAC Name | piperidine-3,5-dione;hydrochloride |
| SMILES | Cl.O=C1CNCC(=O)C1 |
| InChI | InChI=1S/C5H7NO2.ClH/c7-4-1-5(8)3-6-2-4;/h6H,1-3H2;1H |
| InChIKey | ZTJNSMBNILHDHI-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.58 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze piperidine-3,5-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-3,5-dione;hydrochloride?
The IUPAC name of piperidine-3,5-dione;hydrochloride (CID 12637127) is piperidine-3,5-dione;hydrochloride.
What is the SMILES notation for piperidine-3,5-dione;hydrochloride?
The canonical SMILES for piperidine-3,5-dione;hydrochloride is Cl.O=C1CNCC(=O)C1.
What is the InChIKey of piperidine-3,5-dione;hydrochloride?
The InChIKey is ZTJNSMBNILHDHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2.ClH/c7-4-1-5(8)3-6-2-4;/h6H,1-3H2;1H.
What are the key properties of piperidine-3,5-dione;hydrochloride?
piperidine-3,5-dione;hydrochloride has a molecular weight of 149.58 g/mol, XLogP of -0.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-3,5-dione;hydrochloride is sourced from PubChem (CID 12637127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).