C27H27N7O2S — CID 126371340
N-[[4-ethyl-5-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide (PubChem CID 126371340) has the molecular formula C27H27N7O2S and a molecular weight of 513.63 g/mol. Its IUPAC name is N-[[4-ethyl-5-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide.
| Compound Name | N-[[4-ethyl-5-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 126371340 |
| Molecular Formula | C27H27N7O2S |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | N-[[4-ethyl-5-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide |
| SMILES | CCn1c(CNC(=O)c2ccccc2C)nnc1SCC(=O)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C27H27N7O2S/c1-3-34-24(17-28-26(36)23-12-8-7-9-19(23)2)32-33-27(34)37-18-25(35)29-20-13-15-22(16-14-20)31-30-21-10-5-4-6-11-21/h4-16H,3,17-18H2,1-2H3,(H,28,36)(H,29,35)/b31-30+ |
| InChIKey | UIWMADQABPEIMV-NVQSTNCTSA-N |
| XLogP | 5.68 |
| TPSA | 113.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|