C25H38N2O3S — CID 126371917
N-[2-(cyclohexen-1-yl)ethyl]-2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide (PubChem CID 126371917) has the molecular formula C25H38N2O3S and a molecular weight of 446.66 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 126371917 |
| Molecular Formula | C25H38N2O3S |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(CC(=O)NCCC2=CCCCC2)C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C25H38N2O3S/c1-19-16-20(2)25(21(3)17-19)31(29,30)27(23-12-8-5-9-13-23)18-24(28)26-15-14-22-10-6-4-7-11-22/h10,16-17,23H,4-9,11-15,18H2,1-3H3,(H,26,28) |
| InChIKey | PAWLGWVQDCHLGU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|