About 2,4,6-trichloro-N,N-dimethylaniline
2,4,6-trichloro-N,N-dimethylaniline (PubChem CID 12637282) has the molecular formula C8H8Cl3N
and a molecular weight of 224.52 g/mol. Its IUPAC name is 2,4,6-trichloro-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 2,4,6-trichloro-N,N-dimethylaniline |
| PubChem CID | 12637282 |
| Molecular Formula | C8H8Cl3N |
| Molecular Weight | 224.52 g/mol |
| Exact Mass | 222.97 |
| IUPAC Name | 2,4,6-trichloro-N,N-dimethylaniline |
| SMILES | CN(C)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl3N/c1-12(2)8-6(10)3-5(9)4-7(8)11/h3-4H,1-2H3 |
| InChIKey | HRWDWHWDUUWPSV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4,6-trichloro-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-trichloro-N,N-dimethylaniline?
The IUPAC name of 2,4,6-trichloro-N,N-dimethylaniline (CID 12637282) is 2,4,6-trichloro-N,N-dimethylaniline.
What is the SMILES notation for 2,4,6-trichloro-N,N-dimethylaniline?
The canonical SMILES for 2,4,6-trichloro-N,N-dimethylaniline is CN(C)c1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of 2,4,6-trichloro-N,N-dimethylaniline?
The InChIKey is HRWDWHWDUUWPSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl3N/c1-12(2)8-6(10)3-5(9)4-7(8)11/h3-4H,1-2H3.
What are the key properties of 2,4,6-trichloro-N,N-dimethylaniline?
2,4,6-trichloro-N,N-dimethylaniline has a molecular weight of 224.52 g/mol, XLogP of 3.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trichloro-N,N-dimethylaniline is sourced from PubChem (CID 12637282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).