About 3-chloro-N,N,4-trimethylaniline
3-chloro-N,N,4-trimethylaniline (PubChem CID 12637287) has the molecular formula C9H12ClN
and a molecular weight of 169.65 g/mol. Its IUPAC name is 3-chloro-N,N,4-trimethylaniline.
Molecular Properties
| Compound Name | 3-chloro-N,N,4-trimethylaniline |
| PubChem CID | 12637287 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.65 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 3-chloro-N,N,4-trimethylaniline |
| SMILES | Cc1ccc(N(C)C)cc1Cl |
| InChI | InChI=1S/C9H12ClN/c1-7-4-5-8(11(2)3)6-9(7)10/h4-6H,1-3H3 |
| InChIKey | FCIFMZDGGLUIHT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.65 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-N,N,4-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N,N,4-trimethylaniline?
The IUPAC name of 3-chloro-N,N,4-trimethylaniline (CID 12637287) is 3-chloro-N,N,4-trimethylaniline.
What is the SMILES notation for 3-chloro-N,N,4-trimethylaniline?
The canonical SMILES for 3-chloro-N,N,4-trimethylaniline is Cc1ccc(N(C)C)cc1Cl.
What is the InChIKey of 3-chloro-N,N,4-trimethylaniline?
The InChIKey is FCIFMZDGGLUIHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClN/c1-7-4-5-8(11(2)3)6-9(7)10/h4-6H,1-3H3.
What are the key properties of 3-chloro-N,N,4-trimethylaniline?
3-chloro-N,N,4-trimethylaniline has a molecular weight of 169.65 g/mol, XLogP of 2.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N,N,4-trimethylaniline is sourced from PubChem (CID 12637287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).