C24H60Si6 — CID 12637408
1,1,2,2,3,3,4,4,5,5,6,6-dodecaethylhexasilinane (PubChem CID 12637408) has the molecular formula C24H60Si6 and a molecular weight of 517.26 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecaethylhexasilinane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecaethylhexasilinane |
|---|---|
| PubChem CID | 12637408 |
| Molecular Formula | C24H60Si6 |
| Molecular Weight | 517.26 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecaethylhexasilinane |
| SMILES | CC[Si]1(CC)[Si](CC)(CC)[Si](CC)(CC)[Si](CC)(CC)[Si](CC)(CC)[Si]1(CC)CC |
| InChI | InChI=1S/C24H60Si6/c1-13-25(14-2)26(15-3,16-4)28(19-7,20-8)30(23-11,24-12)29(21-9,22-10)27(25,17-5)18-6/h13-24H2,1-12H3 |
| InChIKey | NJCFKZYBDMYHON-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.26 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|