C16H18BrN3OS — CID 126374813
(4R)-4-(5-bromo-2-methoxyphenyl)-6-tert-butyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carbonitrile (PubChem CID 126374813) has the molecular formula C16H18BrN3OS and a molecular weight of 380.31 g/mol. Its IUPAC name is (4R)-4-(5-bromo-2-methoxyphenyl)-6-tert-butyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carbonitrile.
| Compound Name | (4R)-4-(5-bromo-2-methoxyphenyl)-6-tert-butyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 126374813 |
| Molecular Formula | C16H18BrN3OS |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | (4R)-4-(5-bromo-2-methoxyphenyl)-6-tert-butyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1ccc(Br)cc1[C@@H]1NC(=S)NC(C(C)(C)C)=C1C#N |
| InChI | InChI=1S/C16H18BrN3OS/c1-16(2,3)14-11(8-18)13(19-15(22)20-14)10-7-9(17)5-6-12(10)21-4/h5-7,13H,1-4H3,(H2,19,20,22)/t13-/m0/s1 |
| InChIKey | MHAPETYTXYFNNB-ZDUSSCGKSA-N |
| XLogP | 3.80 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|