C16H15Br2NO3 — CID 126374926
6,8-dibromo-N-cyclohexyl-2-oxochromene-3-carboxamide (PubChem CID 126374926) has the molecular formula C16H15Br2NO3 and a molecular weight of 429.11 g/mol. Its IUPAC name is 6,8-dibromo-N-cyclohexyl-2-oxochromene-3-carboxamide.
| Compound Name | 6,8-dibromo-N-cyclohexyl-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 126374926 |
| Molecular Formula | C16H15Br2NO3 |
| Molecular Weight | 429.11 g/mol |
| Exact Mass | 426.94 |
| IUPAC Name | 6,8-dibromo-N-cyclohexyl-2-oxochromene-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc2cc(Br)cc(Br)c2oc1=O |
| InChI | InChI=1S/C16H15Br2NO3/c17-10-6-9-7-12(16(21)22-14(9)13(18)8-10)15(20)19-11-4-2-1-3-5-11/h6-8,11H,1-5H2,(H,19,20) |
| InChIKey | OEOPTDQNDQAOES-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.11 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|