C19H19BrN2O3S — CID 126375460
ethyl (5R)-5-(5-bromo-2-prop-2-enoxyphenyl)-7-methyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126375460) has the molecular formula C19H19BrN2O3S and a molecular weight of 435.34 g/mol. Its IUPAC name is ethyl (5R)-5-(5-bromo-2-prop-2-enoxyphenyl)-7-methyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (5R)-5-(5-bromo-2-prop-2-enoxyphenyl)-7-methyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126375460 |
| Molecular Formula | C19H19BrN2O3S |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | ethyl (5R)-5-(5-bromo-2-prop-2-enoxyphenyl)-7-methyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOc1ccc(Br)cc1[C@@H]1C(C(=O)OCC)=C(C)N=C2SC=CN21 |
| InChI | InChI=1S/C19H19BrN2O3S/c1-4-9-25-15-7-6-13(20)11-14(15)17-16(18(23)24-5-2)12(3)21-19-22(17)8-10-26-19/h4,6-8,10-11,17H,1,5,9H2,2-3H3/t17-/m1/s1 |
| InChIKey | UKMYJYBHGSZBBG-QGZVFWFLSA-N |
| XLogP | 4.78 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|