C23H18BrFN4O5 — CID 126375829
N-[(E)-[3-bromo-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide (PubChem CID 126375829) has the molecular formula C23H18BrFN4O5 and a molecular weight of 529.32 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[(E)-[3-bromo-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126375829 |
| Molecular Formula | C23H18BrFN4O5 |
| Molecular Weight | 529.32 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | N-[(E)-[3-bromo-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])N/N=C/c1ccc(OCC(=O)Nc2ccc(F)cc2)c(Br)c1 |
| InChI | InChI=1S/C23H18BrFN4O5/c24-19-11-15(13-26-28-22(30)12-16-3-1-2-4-20(16)29(32)33)5-10-21(19)34-14-23(31)27-18-8-6-17(25)7-9-18/h1-11,13H,12,14H2,(H,27,31)(H,28,30)/b26-13+ |
| InChIKey | DTRIRMRNEMNYPD-LGJNPRDNSA-N |
| XLogP | 4.21 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|