About 4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride
4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride (PubChem CID 12637656) has the molecular formula C16H16Cl2N6S
and a molecular weight of 395.32 g/mol. Its IUPAC name is 4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride.
Molecular Properties
| Compound Name | 4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride |
| PubChem CID | 12637656 |
| Molecular Formula | C16H16Cl2N6S |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(-c2nnc(-c3ccc(/C(N)=N/[H])cc3)s2)cc1 |
| InChI | InChI=1S/C16H14N6S.2ClH/c17-13(18)9-1-5-11(6-2-9)15-21-22-16(23-15)12-7-3-10(4-8-12)14(19)20;;/h1-8H,(H3,17,18)(H3,19,20);2*1H |
| InChIKey | VLGIZIUNRBKFSF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride?
The IUPAC name of 4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride (CID 12637656) is 4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride.
What is the SMILES notation for 4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride?
The canonical SMILES for 4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride is Cl.Cl.[H]/N=C(\N)c1ccc(-c2nnc(-c3ccc(/C(N)=N/[H])cc3)s2)cc1.
What is the InChIKey of 4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride?
The InChIKey is VLGIZIUNRBKFSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N6S.2ClH/c17-13(18)9-1-5-11(6-2-9)15-21-22-16(23-15)12-7-3-10(4-8-12)14(19)20;;/h1-8H,(H3,17,18)(H3,19,20);2*1H.
What are the key properties of 4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride?
4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride has a molecular weight of 395.32 g/mol, XLogP of 3.28, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-carbamimidoylphenyl)-1,3,4-thiadiazol-2-yl]benzenecarboximidamide;dihydrochloride is sourced from PubChem (CID 12637656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).