C23H18N2O4 — CID 126377255
(1S,2S,6R,7S)-4-(2-nitrophenyl)-10-(1-phenylethylidene)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126377255) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is (1S,2S,6R,7S)-4-(2-nitrophenyl)-10-(1-phenylethylidene)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2S,6R,7S)-4-(2-nitrophenyl)-10-(1-phenylethylidene)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126377255 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (1S,2S,6R,7S)-4-(2-nitrophenyl)-10-(1-phenylethylidene)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | C/C(=C1/[C@H]2C=C[C@H]1[C@H]1C(=O)N(c3ccccc3[N+](=O)[O-])C(=O)[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C23H18N2O4/c1-13(14-7-3-2-4-8-14)19-15-11-12-16(19)21-20(15)22(26)24(23(21)27)17-9-5-6-10-18(17)25(28)29/h2-12,15-16,20-21H,1H3/b19-13-/t15-,16-,20-,21+/m1/s1 |
| InChIKey | NTLQBEFVIVWXLR-LTWKIFAASA-N |
| XLogP | 3.99 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|