About 2-amino-4,5-dichlorobenzenesulfonyl chloride
2-amino-4,5-dichlorobenzenesulfonyl chloride (PubChem CID 12637874) has the molecular formula C6H4Cl3NO2S
and a molecular weight of 260.53 g/mol. Its IUPAC name is 2-amino-4,5-dichlorobenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 2-amino-4,5-dichlorobenzenesulfonyl chloride |
| PubChem CID | 12637874 |
| Molecular Formula | C6H4Cl3NO2S |
| Molecular Weight | 260.53 g/mol |
| Exact Mass | 258.90 |
| IUPAC Name | 2-amino-4,5-dichlorobenzenesulfonyl chloride |
| SMILES | Nc1cc(Cl)c(Cl)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C6H4Cl3NO2S/c7-3-1-5(10)6(2-4(3)8)13(9,11)12/h1-2H,10H2 |
| InChIKey | AHIKUUZQSJTSMX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,5-dichlorobenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-dichlorobenzenesulfonyl chloride?
The IUPAC name of 2-amino-4,5-dichlorobenzenesulfonyl chloride (CID 12637874) is 2-amino-4,5-dichlorobenzenesulfonyl chloride.
What is the SMILES notation for 2-amino-4,5-dichlorobenzenesulfonyl chloride?
The canonical SMILES for 2-amino-4,5-dichlorobenzenesulfonyl chloride is Nc1cc(Cl)c(Cl)cc1S(=O)(=O)Cl.
What is the InChIKey of 2-amino-4,5-dichlorobenzenesulfonyl chloride?
The InChIKey is AHIKUUZQSJTSMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl3NO2S/c7-3-1-5(10)6(2-4(3)8)13(9,11)12/h1-2H,10H2.
What are the key properties of 2-amino-4,5-dichlorobenzenesulfonyl chloride?
2-amino-4,5-dichlorobenzenesulfonyl chloride has a molecular weight of 260.53 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-dichlorobenzenesulfonyl chloride is sourced from PubChem (CID 12637874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).