C18H16INO2 — CID 126382020
(1R,2R,6S,7R)-4-[(4-iodophenyl)methyl]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione (PubChem CID 126382020) has the molecular formula C18H16INO2 and a molecular weight of 405.24 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[(4-iodophenyl)methyl]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[(4-iodophenyl)methyl]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
|---|---|
| PubChem CID | 126382020 |
| Molecular Formula | C18H16INO2 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | (1R,2R,6S,7R)-4-[(4-iodophenyl)methyl]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1Cc1ccc(I)cc1)[C@H]1C=C[C@H]2C12CC2 |
| InChI | InChI=1S/C18H16INO2/c19-11-3-1-10(2-4-11)9-20-16(21)14-12-5-6-13(15(14)17(20)22)18(12)7-8-18/h1-6,12-15H,7-9H2/t12-,13-,14-,15+/m1/s1 |
| InChIKey | HYICAVWZEYIDIY-TUVASFSCSA-N |
| XLogP | 2.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|