C23H15Cl2N3O5S — CID 126384516
(5E)-5-[[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126384516) has the molecular formula C23H15Cl2N3O5S and a molecular weight of 516.36 g/mol. Its IUPAC name is (5E)-5-[[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126384516 |
| Molecular Formula | C23H15Cl2N3O5S |
| Molecular Weight | 516.36 g/mol |
| Exact Mass | 515.01 |
| IUPAC Name | (5E)-5-[[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCc1ccc(N2C(=O)/C(=C/c3ccc(-c4cc([N+](=O)[O-])c(Cl)cc4Cl)o3)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C23H15Cl2N3O5S/c1-2-12-3-5-13(6-4-12)27-22(30)16(21(29)26-23(27)34)9-14-7-8-20(33-14)15-10-19(28(31)32)18(25)11-17(15)24/h3-11H,2H2,1H3,(H,26,29,34)/b16-9+ |
| InChIKey | COXPWOFVEURIEI-CXUHLZMHSA-N |
| XLogP | 5.56 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.36 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|