About 5-aminopyrrolidin-2-one
5-aminopyrrolidin-2-one (PubChem CID 12638466) has the molecular formula C4H8N2O
and a molecular weight of 100.12 g/mol. Its IUPAC name is 5-aminopyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-aminopyrrolidin-2-one |
| PubChem CID | 12638466 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | 5-aminopyrrolidin-2-one |
| SMILES | NC1CCC(=O)N1 |
| InChI | InChI=1S/C4H8N2O/c5-3-1-2-4(7)6-3/h3H,1-2,5H2,(H,6,7) |
| InChIKey | URKYFRSLKUNMFG-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-aminopyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminopyrrolidin-2-one?
The IUPAC name of 5-aminopyrrolidin-2-one (CID 12638466) is 5-aminopyrrolidin-2-one.
What is the SMILES notation for 5-aminopyrrolidin-2-one?
The canonical SMILES for 5-aminopyrrolidin-2-one is NC1CCC(=O)N1.
What is the InChIKey of 5-aminopyrrolidin-2-one?
The InChIKey is URKYFRSLKUNMFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O/c5-3-1-2-4(7)6-3/h3H,1-2,5H2,(H,6,7).
What are the key properties of 5-aminopyrrolidin-2-one?
5-aminopyrrolidin-2-one has a molecular weight of 100.12 g/mol, XLogP of -0.82, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminopyrrolidin-2-one is sourced from PubChem (CID 12638466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).