C26H21ClINO7S — CID 126388898
methyl 5-[[(5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 126388898) has the molecular formula C26H21ClINO7S and a molecular weight of 653.88 g/mol. Its IUPAC name is methyl 5-[[(5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126388898 |
| Molecular Formula | C26H21ClINO7S |
| Molecular Weight | 653.88 g/mol |
| Exact Mass | 652.98 |
| IUPAC Name | methyl 5-[[(5E)-5-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)cc(I)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H21ClINO7S/c1-3-34-21-11-15(10-19(28)23(21)35-14-16-6-4-5-7-18(16)27)12-22-24(30)29(26(32)37-22)13-17-8-9-20(36-17)25(31)33-2/h4-12H,3,13-14H2,1-2H3/b22-12+ |
| InChIKey | BEDRSIXGELGXQC-WSDLNYQXSA-N |
| XLogP | 6.54 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.88 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|