C14H15NO5 — CID 126389795
(1R,2S,3R,4S)-3-(furan-2-ylmethylcarbamoyl)-4-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 126389795) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-(furan-2-ylmethylcarbamoyl)-4-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4S)-3-(furan-2-ylmethylcarbamoyl)-4-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 126389795 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (1R,2S,3R,4S)-3-(furan-2-ylmethylcarbamoyl)-4-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | C[C@@]12C=C[C@@H](O1)[C@@H](C(=O)O)[C@H]2C(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H15NO5/c1-14-5-4-9(20-14)10(13(17)18)11(14)12(16)15-7-8-3-2-6-19-8/h2-6,9-11H,7H2,1H3,(H,15,16)(H,17,18)/t9-,10-,11+,14+/m1/s1 |
| InChIKey | GWGDCKMYIXKSBO-PUHVVEEASA-N |
| XLogP | 0.94 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|