About 1-chloroethanol
1-chloroethanol (PubChem CID 12639035) has the molecular formula C2H5ClO
and a molecular weight of 80.51 g/mol. Its IUPAC name is 1-chloroethanol.
Molecular Properties
| Compound Name | 1-chloroethanol |
| PubChem CID | 12639035 |
| Molecular Formula | C2H5ClO |
| Molecular Weight | 80.51 g/mol |
| Exact Mass | 80.00 |
| IUPAC Name | 1-chloroethanol |
| SMILES | CC(O)Cl |
| InChI | InChI=1S/C2H5ClO/c1-2(3)4/h2,4H,1H3 |
| InChIKey | KJESGYZFVCIMDE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 80.51 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethanol?
The IUPAC name of 1-chloroethanol (CID 12639035) is 1-chloroethanol.
What is the SMILES notation for 1-chloroethanol?
The canonical SMILES for 1-chloroethanol is CC(O)Cl.
What is the InChIKey of 1-chloroethanol?
The InChIKey is KJESGYZFVCIMDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5ClO/c1-2(3)4/h2,4H,1H3.
What are the key properties of 1-chloroethanol?
1-chloroethanol has a molecular weight of 80.51 g/mol, XLogP of 0.56, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethanol is sourced from PubChem (CID 12639035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).