C26H19N3O3 — CID 126391055
4,5-bis(furan-2-yl)-2-[(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]furan-3-carbonitrile (PubChem CID 126391055) has the molecular formula C26H19N3O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is 4,5-bis(furan-2-yl)-2-[(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]furan-3-carbonitrile.
| Compound Name | 4,5-bis(furan-2-yl)-2-[(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]furan-3-carbonitrile |
|---|---|
| PubChem CID | 126391055 |
| Molecular Formula | C26H19N3O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 4,5-bis(furan-2-yl)-2-[(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]furan-3-carbonitrile |
| SMILES | C=CCn1c(C)c(C=Nc2oc(-c3ccco3)c(-c3ccco3)c2C#N)c2ccccc21 |
| InChI | InChI=1S/C26H19N3O3/c1-3-12-29-17(2)20(18-8-4-5-9-21(18)29)16-28-26-19(15-27)24(22-10-6-13-30-22)25(32-26)23-11-7-14-31-23/h3-11,13-14,16H,1,12H2,2H3 |
| InChIKey | LXIDSMUMHRENKS-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 80.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|