C10H10N4S — CID 1263918
1-ethylsulfanyl-3H-[1,2,4]triazolo[4,3-a]benzimidazole (PubChem CID 1263918) has the molecular formula C10H10N4S and a molecular weight of 218.28 g/mol. Its IUPAC name is 1-ethylsulfanyl-3H-[1,2,4]triazolo[4,3-a]benzimidazole.
| Compound Name | 1-ethylsulfanyl-3H-[1,2,4]triazolo[4,3-a]benzimidazole |
|---|---|
| PubChem CID | 1263918 |
| Molecular Formula | C10H10N4S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 1-ethylsulfanyl-3H-[1,2,4]triazolo[4,3-a]benzimidazole |
| SMILES | CCSc1n[nH]c2nc3ccccc3n12 |
| InChI | InChI=1S/C10H10N4S/c1-2-15-10-13-12-9-11-7-5-3-4-6-8(7)14(9)10/h3-6H,2H2,1H3,(H,11,12) |
| InChIKey | BBQNJVMJFMZWON-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |