About 1H-indazole-7-carboxylic acid
1H-indazole-7-carboxylic acid (PubChem CID 12639205) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is 1H-indazole-7-carboxylic acid.
Molecular Properties
| Compound Name | 1H-indazole-7-carboxylic acid |
| PubChem CID | 12639205 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 1H-indazole-7-carboxylic acid |
| SMILES | O=C(O)c1cccc2cn[nH]c12 |
| InChI | InChI=1S/C8H6N2O2/c11-8(12)6-3-1-2-5-4-9-10-7(5)6/h1-4H,(H,9,10)(H,11,12) |
| InChIKey | WBCWIQCXHSXMDH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indazole-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazole-7-carboxylic acid?
The IUPAC name of 1H-indazole-7-carboxylic acid (CID 12639205) is 1H-indazole-7-carboxylic acid.
What is the SMILES notation for 1H-indazole-7-carboxylic acid?
The canonical SMILES for 1H-indazole-7-carboxylic acid is O=C(O)c1cccc2cn[nH]c12.
What is the InChIKey of 1H-indazole-7-carboxylic acid?
The InChIKey is WBCWIQCXHSXMDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c11-8(12)6-3-1-2-5-4-9-10-7(5)6/h1-4H,(H,9,10)(H,11,12).
What are the key properties of 1H-indazole-7-carboxylic acid?
1H-indazole-7-carboxylic acid has a molecular weight of 162.15 g/mol, XLogP of 1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazole-7-carboxylic acid is sourced from PubChem (CID 12639205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).