C21H26Cl2N2O4S — CID 126393830
2-[benzenesulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 126393830) has the molecular formula C21H26Cl2N2O4S and a molecular weight of 473.42 g/mol. Its IUPAC name is 2-[benzenesulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[benzenesulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 126393830 |
| Molecular Formula | C21H26Cl2N2O4S |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 2-[benzenesulfonyl-[(2,4-dichlorophenyl)methyl]amino]-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | CC(C)OCCCNC(=O)CN(Cc1ccc(Cl)cc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H26Cl2N2O4S/c1-16(2)29-12-6-11-24-21(26)15-25(14-17-9-10-18(22)13-20(17)23)30(27,28)19-7-4-3-5-8-19/h3-5,7-10,13,16H,6,11-12,14-15H2,1-2H3,(H,24,26) |
| InChIKey | PLAQKGXHGRGSOT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|