C15H19N3O3S — CID 126394497
(5E)-5-[[5-(diethylamino)furan-2-yl]methylidene]-1-ethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126394497) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is (5E)-5-[[5-(diethylamino)furan-2-yl]methylidene]-1-ethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[[5-(diethylamino)furan-2-yl]methylidene]-1-ethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126394497 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (5E)-5-[[5-(diethylamino)furan-2-yl]methylidene]-1-ethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN1C(=O)/C(=C/c2ccc(N(CC)CC)o2)C(=O)NC1=S |
| InChI | InChI=1S/C15H19N3O3S/c1-4-17(5-2)12-8-7-10(21-12)9-11-13(19)16-15(22)18(6-3)14(11)20/h7-9H,4-6H2,1-3H3,(H,16,19,22)/b11-9+ |
| InChIKey | BDTWMLXHHCKCJN-PKNBQFBNSA-N |
| XLogP | 1.77 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|