About CID 12639584
CID 12639584 (PubChem CID 12639584) has the molecular formula C12H22Si
and a molecular weight of 194.39 g/mol.
Molecular Properties
| Compound Name | CID 12639584 |
| PubChem CID | 12639584 |
| Molecular Formula | C12H22Si |
| Molecular Weight | 194.39 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | — |
| SMILES | C1CCC([Si]C2CCCCC2)CC1 |
| InChI | InChI=1S/C12H22Si/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h11-12H,1-10H2 |
| InChIKey | TWDYJTLOVCQUPB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 12639584 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12639584?
The IUPAC name of CID 12639584 (CID 12639584) is not available.
What is the SMILES notation for CID 12639584?
The canonical SMILES for CID 12639584 is C1CCC([Si]C2CCCCC2)CC1.
What is the InChIKey of CID 12639584?
The InChIKey is TWDYJTLOVCQUPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22Si/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h11-12H,1-10H2.
What are the key properties of CID 12639584?
CID 12639584 has a molecular weight of 194.39 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12639584 is sourced from PubChem (CID 12639584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).