C28H34N2O5S — CID 126395918
N-(4-butylphenyl)-2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide (PubChem CID 126395918) has the molecular formula C28H34N2O5S and a molecular weight of 510.66 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide.
| Compound Name | N-(4-butylphenyl)-2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 126395918 |
| Molecular Formula | C28H34N2O5S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | N-(4-butylphenyl)-2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
| SMILES | CCCCc1ccc(NC(=O)CN(CCc2ccccc2)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H34N2O5S/c1-4-5-9-23-12-14-24(15-13-23)29-28(31)21-30(19-18-22-10-7-6-8-11-22)36(32,33)25-16-17-26(34-2)27(20-25)35-3/h6-8,10-17,20H,4-5,9,18-19,21H2,1-3H3,(H,29,31) |
| InChIKey | YIYVOBRQVZQPSI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |