C24H16Br2FN3O2 — CID 126395949
(Z)-3-[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 126395949) has the molecular formula C24H16Br2FN3O2 and a molecular weight of 557.22 g/mol. Its IUPAC name is (Z)-3-[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126395949 |
| Molecular Formula | C24H16Br2FN3O2 |
| Molecular Weight | 557.22 g/mol |
| Exact Mass | 554.96 |
| IUPAC Name | (Z)-3-[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | COc1ccc2nc(/C(C#N)=C\c3cc(Br)c(OCc4ccccc4F)c(Br)c3)[nH]c2c1 |
| InChI | InChI=1S/C24H16Br2FN3O2/c1-31-17-6-7-21-22(11-17)30-24(29-21)16(12-28)8-14-9-18(25)23(19(26)10-14)32-13-15-4-2-3-5-20(15)27/h2-11H,13H2,1H3,(H,29,30)/b16-8- |
| InChIKey | JDZYHLJJVWRWNA-PXNMLYILSA-N |
| XLogP | 6.88 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.22 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|