About 2,5-ditert-butyl-1,3-oxazole
2,5-ditert-butyl-1,3-oxazole (PubChem CID 12639618) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 2,5-ditert-butyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2,5-ditert-butyl-1,3-oxazole |
| PubChem CID | 12639618 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2,5-ditert-butyl-1,3-oxazole |
| SMILES | CC(C)(C)c1cnc(C(C)(C)C)o1 |
| InChI | InChI=1S/C11H19NO/c1-10(2,3)8-7-12-9(13-8)11(4,5)6/h7H,1-6H3 |
| InChIKey | LAECWCUYYXKGDE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-ditert-butyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butyl-1,3-oxazole?
The IUPAC name of 2,5-ditert-butyl-1,3-oxazole (CID 12639618) is 2,5-ditert-butyl-1,3-oxazole.
What is the SMILES notation for 2,5-ditert-butyl-1,3-oxazole?
The canonical SMILES for 2,5-ditert-butyl-1,3-oxazole is CC(C)(C)c1cnc(C(C)(C)C)o1.
What is the InChIKey of 2,5-ditert-butyl-1,3-oxazole?
The InChIKey is LAECWCUYYXKGDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-10(2,3)8-7-12-9(13-8)11(4,5)6/h7H,1-6H3.
What are the key properties of 2,5-ditert-butyl-1,3-oxazole?
2,5-ditert-butyl-1,3-oxazole has a molecular weight of 181.28 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butyl-1,3-oxazole is sourced from PubChem (CID 12639618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).