About 2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole
2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole (PubChem CID 12639669) has the molecular formula C10H18N2O6S
and a molecular weight of 294.33 g/mol. Its IUPAC name is 2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole |
| PubChem CID | 12639669 |
| Molecular Formula | C10H18N2O6S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole |
| SMILES | COC(OC)(OC)c1nnc(C(OC)(OC)OC)s1 |
| InChI | InChI=1S/C10H18N2O6S/c1-13-9(14-2,15-3)7-11-12-8(19-7)10(16-4,17-5)18-6/h1-6H3 |
| InChIKey | VQSOEVDJBFCYAE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole?
The IUPAC name of 2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole (CID 12639669) is 2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole.
What is the SMILES notation for 2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole?
The canonical SMILES for 2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole is COC(OC)(OC)c1nnc(C(OC)(OC)OC)s1.
What is the InChIKey of 2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole?
The InChIKey is VQSOEVDJBFCYAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O6S/c1-13-9(14-2,15-3)7-11-12-8(19-7)10(16-4,17-5)18-6/h1-6H3.
What are the key properties of 2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole?
2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole has a molecular weight of 294.33 g/mol, XLogP of 0.64, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(trimethoxymethyl)-1,3,4-thiadiazole is sourced from PubChem (CID 12639669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).