C24H17FIN3O2 — CID 126396847
(Z)-3-[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 126396847) has the molecular formula C24H17FIN3O2 and a molecular weight of 525.32 g/mol. Its IUPAC name is (Z)-3-[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126396847 |
| Molecular Formula | C24H17FIN3O2 |
| Molecular Weight | 525.32 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | (Z)-3-[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | COc1ccc2nc(/C(C#N)=C\c3ccc(OCc4cccc(F)c4)c(I)c3)[nH]c2c1 |
| InChI | InChI=1S/C24H17FIN3O2/c1-30-19-6-7-21-22(12-19)29-24(28-21)17(13-27)9-15-5-8-23(20(26)11-15)31-14-16-3-2-4-18(25)10-16/h2-12H,14H2,1H3,(H,28,29)/b17-9- |
| InChIKey | OVKQPGPXJLQWQQ-MFOYZWKCSA-N |
| XLogP | 5.96 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.32 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|