C9H4Cl4N2S2 — CID 12639709
2-(4-chlorophenyl)sulfanyl-5-(trichloromethyl)-1,3,4-thiadiazole (PubChem CID 12639709) has the molecular formula C9H4Cl4N2S2 and a molecular weight of 346.09 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-5-(trichloromethyl)-1,3,4-thiadiazole.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-5-(trichloromethyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 12639709 |
| Molecular Formula | C9H4Cl4N2S2 |
| Molecular Weight | 346.09 g/mol |
| Exact Mass | 343.86 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-5-(trichloromethyl)-1,3,4-thiadiazole |
| SMILES | Clc1ccc(Sc2nnc(C(Cl)(Cl)Cl)s2)cc1 |
| InChI | InChI=1S/C9H4Cl4N2S2/c10-5-1-3-6(4-2-5)16-8-15-14-7(17-8)9(11,12)13/h1-4H |
| InChIKey | MLEILCFHQGWUIJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.09 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|