About N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine
N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 12639710) has the molecular formula C5H6Cl3N3S
and a molecular weight of 246.55 g/mol. Its IUPAC name is N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine |
| PubChem CID | 12639710 |
| Molecular Formula | C5H6Cl3N3S |
| Molecular Weight | 246.55 g/mol |
| Exact Mass | 244.93 |
| IUPAC Name | N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CN(C)c1nnc(C(Cl)(Cl)Cl)s1 |
| InChI | InChI=1S/C5H6Cl3N3S/c1-11(2)4-10-9-3(12-4)5(6,7)8/h1-2H3 |
| InChIKey | MTJRBCCWZLMIDM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine?
The IUPAC name of N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine (CID 12639710) is N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine?
The canonical SMILES for N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine is CN(C)c1nnc(C(Cl)(Cl)Cl)s1.
What is the InChIKey of N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine?
The InChIKey is MTJRBCCWZLMIDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6Cl3N3S/c1-11(2)4-10-9-3(12-4)5(6,7)8/h1-2H3.
What are the key properties of N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine?
N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine has a molecular weight of 246.55 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-5-(trichloromethyl)-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 12639710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).