About copper(1+);1,3,5-trimethylbenzene-6-ide
copper(1+);1,3,5-trimethylbenzene-6-ide (PubChem CID 12639866) has the molecular formula C9H11Cu
and a molecular weight of 182.73 g/mol. Its IUPAC name is copper(1+);1,3,5-trimethylbenzene-6-ide.
Molecular Properties
| Compound Name | copper(1+);1,3,5-trimethylbenzene-6-ide |
| PubChem CID | 12639866 |
| Molecular Formula | C9H11Cu |
| Molecular Weight | 182.73 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | copper(1+);1,3,5-trimethylbenzene-6-ide |
| SMILES | Cc1[c-]c(C)cc(C)c1.[Cu+] |
| InChI | InChI=1S/C9H11.Cu/c1-7-4-8(2)6-9(3)5-7;/h4-5H,1-3H3;/q-1;+1 |
| InChIKey | TYIFJJCPKPPNPM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.73 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);1,3,5-trimethylbenzene-6-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);1,3,5-trimethylbenzene-6-ide?
The IUPAC name of copper(1+);1,3,5-trimethylbenzene-6-ide (CID 12639866) is copper(1+);1,3,5-trimethylbenzene-6-ide.
What is the SMILES notation for copper(1+);1,3,5-trimethylbenzene-6-ide?
The canonical SMILES for copper(1+);1,3,5-trimethylbenzene-6-ide is Cc1[c-]c(C)cc(C)c1.[Cu+].
What is the InChIKey of copper(1+);1,3,5-trimethylbenzene-6-ide?
The InChIKey is TYIFJJCPKPPNPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11.Cu/c1-7-4-8(2)6-9(3)5-7;/h4-5H,1-3H3;/q-1;+1.
What are the key properties of copper(1+);1,3,5-trimethylbenzene-6-ide?
copper(1+);1,3,5-trimethylbenzene-6-ide has a molecular weight of 182.73 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);1,3,5-trimethylbenzene-6-ide is sourced from PubChem (CID 12639866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).