C33H26BrCl2N3O5 — CID 126399267
[4-bromo-2-[[(4,6-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3,4-diethoxybenzoate (PubChem CID 126399267) has the molecular formula C33H26BrCl2N3O5 and a molecular weight of 695.40 g/mol. Its IUPAC name is [4-bromo-2-[[(4,6-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3,4-diethoxybenzoate.
| Compound Name | [4-bromo-2-[[(4,6-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 126399267 |
| Molecular Formula | C33H26BrCl2N3O5 |
| Molecular Weight | 695.40 g/mol |
| Exact Mass | 693.04 |
| IUPAC Name | [4-bromo-2-[[(4,6-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(Br)cc2C=NNC(=O)c2[nH]c3cc(Cl)cc(Cl)c3c2-c2ccccc2)cc1OCC |
| InChI | InChI=1S/C33H26BrCl2N3O5/c1-3-42-27-12-10-20(15-28(27)43-4-2)33(41)44-26-13-11-22(34)14-21(26)18-37-39-32(40)31-29(19-8-6-5-7-9-19)30-24(36)16-23(35)17-25(30)38-31/h5-18,38H,3-4H2,1-2H3,(H,39,40) |
| InChIKey | FDAUFMQEHVEKHM-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.40 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|