C30H18Br2Cl3N3O3 — CID 126400106
[2,4-dibromo-6-[[[5,7-dichloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate (PubChem CID 126400106) has the molecular formula C30H18Br2Cl3N3O3 and a molecular weight of 734.66 g/mol. Its IUPAC name is [2,4-dibromo-6-[[[5,7-dichloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate.
| Compound Name | [2,4-dibromo-6-[[[5,7-dichloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126400106 |
| Molecular Formula | C30H18Br2Cl3N3O3 |
| Molecular Weight | 734.66 g/mol |
| Exact Mass | 730.88 |
| IUPAC Name | [2,4-dibromo-6-[[[5,7-dichloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2c(Br)cc(Br)cc2C=NNC(=O)c2[nH]c3c(Cl)cc(Cl)cc3c2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C30H18Br2Cl3N3O3/c1-15-6-8-16(9-7-15)30(40)41-28-17(10-18(31)11-22(28)32)14-36-38-29(39)27-25(20-4-2-3-5-23(20)34)21-12-19(33)13-24(35)26(21)37-27/h2-14,37H,1H3,(H,38,39) |
| InChIKey | PBRBHILERAFIDB-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.66 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|