C24H18ClN3O4 — CID 126406959
[4-chloro-2-methoxy-6-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenyl] acetate (PubChem CID 126406959) has the molecular formula C24H18ClN3O4 and a molecular weight of 447.88 g/mol. Its IUPAC name is [4-chloro-2-methoxy-6-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenyl] acetate.
| Compound Name | [4-chloro-2-methoxy-6-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenyl] acetate |
|---|---|
| PubChem CID | 126406959 |
| Molecular Formula | C24H18ClN3O4 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [4-chloro-2-methoxy-6-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenyl] acetate |
| SMILES | COc1cc(Cl)cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)c1OC(C)=O |
| InChI | InChI=1S/C24H18ClN3O4/c1-15(29)32-22-17(12-18(25)13-21(22)31-2)14-26-28-23(16-8-4-3-5-9-16)27-20-11-7-6-10-19(20)24(28)30/h3-14H,1-2H3 |
| InChIKey | IFIKGKVCKGKBRC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|