C7H4F8N2 — CID 12640722
3,5-bis(1,1,2,2-tetrafluoroethyl)-1H-pyrazole (PubChem CID 12640722) has the molecular formula C7H4F8N2 and a molecular weight of 268.11 g/mol. Its IUPAC name is 3,5-bis(1,1,2,2-tetrafluoroethyl)-1H-pyrazole.
| Compound Name | 3,5-bis(1,1,2,2-tetrafluoroethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 12640722 |
| Molecular Formula | C7H4F8N2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 3,5-bis(1,1,2,2-tetrafluoroethyl)-1H-pyrazole |
| SMILES | FC(F)C(F)(F)c1cc(C(F)(F)C(F)F)[nH]n1 |
| InChI | InChI=1S/C7H4F8N2/c8-4(9)6(12,13)2-1-3(17-16-2)7(14,15)5(10)11/h1,4-5H,(H,16,17) |
| InChIKey | CMTBQYDUVVYYPW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|