About 5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole
5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole (PubChem CID 12640730) has the molecular formula C31H22F2N4
and a molecular weight of 488.54 g/mol. Its IUPAC name is 5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole.
Molecular Properties
| Compound Name | 5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole |
| PubChem CID | 12640730 |
| Molecular Formula | C31H22F2N4 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole |
| SMILES | FC(F)(c1cc(-c2ccccc2)nn1-c1ccccc1)c1cc(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C31H22F2N4/c32-31(33,29-21-27(23-13-5-1-6-14-23)34-36(29)25-17-9-3-10-18-25)30-22-28(24-15-7-2-8-16-24)35-37(30)26-19-11-4-12-20-26/h1-22H |
| InChIKey | DFSOGEIJBDGYIT-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole?
The IUPAC name of 5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole (CID 12640730) is 5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole.
What is the SMILES notation for 5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole?
The canonical SMILES for 5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole is FC(F)(c1cc(-c2ccccc2)nn1-c1ccccc1)c1cc(-c2ccccc2)nn1-c1ccccc1.
What is the InChIKey of 5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole?
The InChIKey is DFSOGEIJBDGYIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H22F2N4/c32-31(33,29-21-27(23-13-5-1-6-14-23)34-36(29)25-17-9-3-10-18-25)30-22-28(24-15-7-2-8-16-24)35-37(30)26-19-11-4-12-20-26/h1-22H.
What are the key properties of 5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole?
5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole has a molecular weight of 488.54 g/mol, XLogP of 7.53, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1,3-diphenylpyrazol-5-yl)-difluoromethyl]-1,3-diphenylpyrazole is sourced from PubChem (CID 12640730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).