C28H21BrN2O4 — CID 126408057
(4Z)-4-[[5-bromo-3-methoxy-2-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione (PubChem CID 126408057) has the molecular formula C28H21BrN2O4 and a molecular weight of 529.39 g/mol. Its IUPAC name is (4Z)-4-[[5-bromo-3-methoxy-2-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione.
| Compound Name | (4Z)-4-[[5-bromo-3-methoxy-2-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 126408057 |
| Molecular Formula | C28H21BrN2O4 |
| Molecular Weight | 529.39 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | (4Z)-4-[[5-bromo-3-methoxy-2-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-phenylpyrazolidine-3,5-dione |
| SMILES | COc1cc(Br)cc(/C=C2/C(=O)NN(c3ccccc3)C2=O)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C28H21BrN2O4/c1-34-25-16-21(29)14-20(15-24-27(32)30-31(28(24)33)22-11-3-2-4-12-22)26(25)35-17-19-10-7-9-18-8-5-6-13-23(18)19/h2-16H,17H2,1H3,(H,30,32)/b24-15- |
| InChIKey | ACENCVOHTHDAMX-IWIPYMOSSA-N |
| XLogP | 5.65 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.39 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|