C20H24N2O3S — CID 126412627
2-(benzenesulfonamido)-N-cycloheptylbenzamide (PubChem CID 126412627) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-cycloheptylbenzamide.
| Compound Name | 2-(benzenesulfonamido)-N-cycloheptylbenzamide |
|---|---|
| PubChem CID | 126412627 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-(benzenesulfonamido)-N-cycloheptylbenzamide |
| SMILES | O=C(NC1CCCCCC1)c1ccccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O3S/c23-20(21-16-10-4-1-2-5-11-16)18-14-8-9-15-19(18)22-26(24,25)17-12-6-3-7-13-17/h3,6-9,12-16,22H,1-2,4-5,10-11H2,(H,21,23) |
| InChIKey | JRULBOZDDQKOIZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |