About trityl 2-methylprop-2-enoate
trityl 2-methylprop-2-enoate (PubChem CID 12641353) has the molecular formula C23H20O2
and a molecular weight of 328.41 g/mol. Its IUPAC name is trityl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | trityl 2-methylprop-2-enoate |
| PubChem CID | 12641353 |
| Molecular Formula | C23H20O2 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | trityl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20O2/c1-18(2)22(24)25-23(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17H,1H2,2H3 |
| InChIKey | PTVDYMGQGCNETM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze trityl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trityl 2-methylprop-2-enoate?
The IUPAC name of trityl 2-methylprop-2-enoate (CID 12641353) is trityl 2-methylprop-2-enoate.
What is the SMILES notation for trityl 2-methylprop-2-enoate?
The canonical SMILES for trityl 2-methylprop-2-enoate is C=C(C)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of trityl 2-methylprop-2-enoate?
The InChIKey is PTVDYMGQGCNETM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20O2/c1-18(2)22(24)25-23(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17H,1H2,2H3.
What are the key properties of trityl 2-methylprop-2-enoate?
trityl 2-methylprop-2-enoate has a molecular weight of 328.41 g/mol, XLogP of 5.10, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trityl 2-methylprop-2-enoate is sourced from PubChem (CID 12641353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).