C26H23N3O4S — CID 126413663
2-[N-(benzenesulfonyl)-4-phenoxyanilino]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 126413663) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-phenoxyanilino]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-phenoxyanilino]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 126413663 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-phenoxyanilino]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | O=C(CN(c1ccc(Oc2ccccc2)cc1)S(=O)(=O)c1ccccc1)NCc1cccnc1 |
| InChI | InChI=1S/C26H23N3O4S/c30-26(28-19-21-8-7-17-27-18-21)20-29(34(31,32)25-11-5-2-6-12-25)22-13-15-24(16-14-22)33-23-9-3-1-4-10-23/h1-18H,19-20H2,(H,28,30) |
| InChIKey | HHCYYJJRBFJDCB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |