C20H21N3O10S — CID 126414254
dimethyl 2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 126414254) has the molecular formula C20H21N3O10S and a molecular weight of 495.47 g/mol. Its IUPAC name is dimethyl 2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 126414254 |
| Molecular Formula | C20H21N3O10S |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | dimethyl 2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)CN(c2cc([N+](=O)[O-])ccc2OC)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H21N3O10S/c1-31-17-8-6-13(23(27)28)10-16(17)22(34(4,29)30)11-18(24)21-15-9-12(19(25)32-2)5-7-14(15)20(26)33-3/h5-10H,11H2,1-4H3,(H,21,24) |
| InChIKey | JXBYGIGIWFEJTA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 171.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|