C21H15Cl2F3N2O3S — CID 126415021
4-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(3-methylphenyl)sulfamoyl]benzamide (PubChem CID 126415021) has the molecular formula C21H15Cl2F3N2O3S and a molecular weight of 503.33 g/mol. Its IUPAC name is 4-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(3-methylphenyl)sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(3-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 126415021 |
| Molecular Formula | C21H15Cl2F3N2O3S |
| Molecular Weight | 503.33 g/mol |
| Exact Mass | 502.01 |
| IUPAC Name | 4-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(3-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(C(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)ccc2Cl)c1 |
| InChI | InChI=1S/C21H15Cl2F3N2O3S/c1-12-3-2-4-15(9-12)28-32(30,31)19-10-13(5-7-18(19)23)20(29)27-14-6-8-17(22)16(11-14)21(24,25)26/h2-11,28H,1H3,(H,27,29) |
| InChIKey | ZRAVSMBHDWTFMB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.33 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |