C17H17Cl3N2O4S — CID 126415640
N-[(2-methoxyphenyl)methyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide (PubChem CID 126415640) has the molecular formula C17H17Cl3N2O4S and a molecular weight of 451.76 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126415640 |
| Molecular Formula | C17H17Cl3N2O4S |
| Molecular Weight | 451.76 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
| SMILES | COc1ccccc1CNC(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C17H17Cl3N2O4S/c1-26-16-6-4-3-5-11(16)9-21-17(23)10-22(27(2,24)25)15-8-13(19)12(18)7-14(15)20/h3-8H,9-10H2,1-2H3,(H,21,23) |
| InChIKey | FONMEYWUVWSJCH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.76 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|