C21H24N2O — CID 126417107
N-[(1S,5R,6R,7S)-7-phenyl-6-bicyclo[3.2.0]heptanyl]-3-pyridin-3-ylpropanamide (PubChem CID 126417107) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is N-[(1S,5R,6R,7S)-7-phenyl-6-bicyclo[3.2.0]heptanyl]-3-pyridin-3-ylpropanamide.
| Compound Name | N-[(1S,5R,6R,7S)-7-phenyl-6-bicyclo[3.2.0]heptanyl]-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 126417107 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N-[(1S,5R,6R,7S)-7-phenyl-6-bicyclo[3.2.0]heptanyl]-3-pyridin-3-ylpropanamide |
| SMILES | O=C(CCc1cccnc1)N[C@@H]1[C@@H]2CCC[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H24N2O/c24-19(12-11-15-6-5-13-22-14-15)23-21-18-10-4-9-17(18)20(21)16-7-2-1-3-8-16/h1-3,5-8,13-14,17-18,20-21H,4,9-12H2,(H,23,24)/t17-,18+,20+,21+/m0/s1 |
| InChIKey | AGOQOTOIUNIUBI-UYWIDEMCSA-N |
| XLogP | 3.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |