C23H24N6O3 — CID 126417910
(3R)-3-[3-oxo-3-[(3R)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]propyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (PubChem CID 126417910) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is (3R)-3-[3-oxo-3-[(3R)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]propyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione.
| Compound Name | (3R)-3-[3-oxo-3-[(3R)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]propyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 126417910 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (3R)-3-[3-oxo-3-[(3R)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]propyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| SMILES | O=C1N[C@H](CCC(=O)N2CCC[C@@H](c3nnc4ccccn34)C2)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C23H24N6O3/c30-20(11-10-18-23(32)24-17-8-2-1-7-16(17)22(31)25-18)28-12-5-6-15(14-28)21-27-26-19-9-3-4-13-29(19)21/h1-4,7-9,13,15,18H,5-6,10-12,14H2,(H,24,32)(H,25,31)/t15-,18-/m1/s1 |
| InChIKey | WAPOQUUJESQJHV-CRAIPNDOSA-N |
| XLogP | 1.97 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |