C22H28N4O2 — CID 126418654
N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-methyl-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxamide (PubChem CID 126418654) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-methyl-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxamide.
| Compound Name | N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-methyl-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 126418654 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | N-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-methyl-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxamide |
| SMILES | CN(C[C@@H]1CCCN2CCCC[C@@H]12)C(=O)c1[nH]nc2c1COc1ccccc1-2 |
| InChI | InChI=1S/C22H28N4O2/c1-25(13-15-7-6-12-26-11-5-4-9-18(15)26)22(27)21-17-14-28-19-10-3-2-8-16(19)20(17)23-24-21/h2-3,8,10,15,18H,4-7,9,11-14H2,1H3,(H,23,24)/t15-,18-/m0/s1 |
| InChIKey | VJPYQZQXTDYNTI-YJBOKZPZSA-N |
| XLogP | 3.31 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |