C25H25N3O5 — CID 126418908
(3R)-1-acetyl-3-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(4-hydroxyphenyl)methyl]pyrrolidine-2,4-dione (PubChem CID 126418908) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is (3R)-1-acetyl-3-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(4-hydroxyphenyl)methyl]pyrrolidine-2,4-dione.
| Compound Name | (3R)-1-acetyl-3-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(4-hydroxyphenyl)methyl]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 126418908 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (3R)-1-acetyl-3-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(4-hydroxyphenyl)methyl]pyrrolidine-2,4-dione |
| SMILES | CC(=O)N1CC(=O)[C@@H]([C@H](c2ccc(O)cc2)c2n(Cc3ccccc3)c(C)c(C)[n+]2[O-])C1=O |
| InChI | InChI=1S/C25H25N3O5/c1-15-16(2)28(33)24(26(15)13-18-7-5-4-6-8-18)22(19-9-11-20(30)12-10-19)23-21(31)14-27(17(3)29)25(23)32/h4-12,22-23,30H,13-14H2,1-3H3/t22-,23-/m0/s1 |
| InChIKey | KRKGEVZJBDRFPY-GOTSBHOMSA-N |
| XLogP | 2.20 |
| TPSA | 106.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|