C17H20N4O5 — CID 126418925
5-[(S)-furan-2-yl-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 126418925) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is 5-[(S)-furan-2-yl-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(S)-furan-2-yl-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126418925 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 5-[(S)-furan-2-yl-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1c(C)[n+]([O-])c([C@@H](c2ccco2)C2C(=O)N(C)C(=O)N(C)C2=O)n1C |
| InChI | InChI=1S/C17H20N4O5/c1-9-10(2)21(25)14(18(9)3)12(11-7-6-8-26-11)13-15(22)19(4)17(24)20(5)16(13)23/h6-8,12-13H,1-5H3/t12-/m0/s1 |
| InChIKey | LNCOSQLCRDCUKY-LBPRGKRZSA-N |
| XLogP | 0.67 |
| TPSA | 102.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|